Home
Products
Cyclo(L-Pro-L-Val)
| Product Name | Cyclo(L-Pro-L-Val) |
| Price: | Inquiry |
| Catalog No.: | CN00009 |
| CAS No.: | 2854-40-2 |
| Molecular Formula: | C10H16N2O2 |
| Molecular Weight: | 196.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC([C@@H]1NC(=O)[C@H]2N(C1=O)CCC2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cyclo(L-Pro-L-Val) is a 2,5-diketopiperazine, with toxic activity against phytopathogenic microorganisms (such as R. fascians LMG 3605). Cyclo(L-Pro-L-Val) shows toxicity similar to Chloramphenicol (HY-B0239) with comparable concentration. Cyclo(L-Pro-L-Val) can also inhibit gram-positive phytopathogenic bacterium. Cyclo(L-Pro-L-Val) has potential development as biopesticide[1]. |
| Exact Mass | 196.12100 |
| PSA | 49.41000 |
| LogP | 0.39850 |