Home
Products
Aloin B
| Product Name | Aloin B |
| Price: | $117 / 10mg |
| Catalog No.: | CN05976 |
| CAS No.: | 28371-16-6 |
| Molecular Formula: | C21H22O9 |
| Molecular Weight: | 418.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Anthraquinones |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Aloe vera L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCc1cc(O)c2c(c1)[C@H]([C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)c1c(C2=O)c(O)ccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Aloin B is one isomer of Aloin; Aloin is a physiologically active anthraquinone present in aloe. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 752.6±60.0 °C at 760 mmHg |
| Flash Point | 268.0±26.4 °C |
| Exact Mass | 418.126373 |
| PSA | 167.91000 |
| LogP | 1.86 |
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
| Storage condition | -20°C |