Home
Products
Bellidifolin
| Product Name | Bellidifolin |
| Price: | $190 / 10mg |
| Catalog No.: | CN05750 |
| CAS No.: | 2798-25-6 |
| Molecular Formula: | C14H10O6 |
| Molecular Weight: | 274.22 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Powder |
| Source: | The plants of Gentiana species. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1)oc1c(c2=O)c(O)ccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Bellidifolin is a xanthone isolated from the stems of Swertia punicea, with hepatoprotective, hypoglycemic, anti-oxidation, anti-inflammatory and antitumor activities[1][2][3]. Bellidifolin also acts as a viral protein R (Vpr) inhibitor[4]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 580.2±50.0 °C at 760 mmHg |
| Flash Point | 228.0±23.6 °C |
| Exact Mass | 274.047729 |
| PSA | 100.13000 |
| LogP | 0.90 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Storage condition | 2-8C |