Home
Products
Gardenin B
| Product Name | Gardenin B |
| Price: | $146 / 10mg |
| Catalog No.: | CN04836 |
| CAS No.: | 2798-20-1 |
| Molecular Formula: | C19H18O7 |
| Molecular Weight: | 358.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The fruits of Gardenia jasminoides Ellis. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc(cc1)c1cc(=O)c2c(o1)c(OC)c(c(c2O)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gardenin B is a flavonoid isolated from Baccharis scandens. Gardenin B induces cell death in human leukemia cells involves multiple caspases[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 582.0±50.0 °C at 760 mmHg |
| Flash Point | 210.8±23.6 °C |
| Exact Mass | 358.105255 |
| PSA | 87.36000 |
| LogP | 2.27 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |