Home
Products
Sunset yellow
| Product Name | Sunset yellow |
| Price: | $23 / 20mg |
| Catalog No.: | CN06663 |
| CAS No.: | 2783-94-0 |
| Molecular Formula: | C16H10N2Na2O7S2 |
| Molecular Weight: | 452.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Yellow powder |
| Source: | |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1ccc2c(c1N=Nc1ccc(cc1)S(=O)(=O)[O-])ccc(c2)S(=O)(=O)[O-].[Na+].[Na+] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Sunset Yellow FCF is a petroleum-derived orange azo dye with a pH dependent maximum absorption at about 480 nm at pH 1 and 443 nm at pH 13. Sunset Yellow is used in food, cosmetics, and drugs. |
| Exact Mass | 451.972473 |
| PSA | 176.11000 |
| LogP | 4.93060 |