Home
Products
Baccatin III
| Product Name | Baccatin III |
| Price: | $37 / 20mg |
| Catalog No.: | CN08855 |
| CAS No.: | 27548-93-2 |
| Molecular Formula: | C31H38O11 |
| Molecular Weight: | 586.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Cryst. |
| Source: | The barks of Taxus chinensis |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@H]1C(=O)[C@]2(C)[C@@H](O)C[C@@H]3[C@]([C@H]2[C@@H]([C@]2(C(C1=C(C)[C@@H](O)C2)(C)C)O)OC(=O)c1ccccc1)(CO3)OC(=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Baccatin III is a natural product isolated from Pacific yew tree and related species. Baccatin III reduces tumor progression by inhibiting the accumulation and suppressive function of MDSCs[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 713.6±60.0 °C at 760 mmHg |
| Flash Point | 226.9±26.4 °C |
| Exact Mass | 586.241394 |
| PSA | 165.89000 |
| LogP | 4.06 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Storage condition | 2-8°C |