Home
Products
Feretoside
| Product Name | Feretoside |
| Price: | Inquiry |
| Catalog No.: | CN03159 |
| CAS No.: | 27530-67-2 |
| Molecular Formula: | C17H24O11 |
| Molecular Weight: | 404.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The barks of Eucommia ulmoides |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1=C[C@H]([C@H]2[C@@H]1[C@@H](OC=C2C(=O)OC)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Feretoside, a phenolic compound extracted from the barks of E. ulmoides, is a HSP inducer which act as cytoprotective agent. |
| Target | HSP[1] |
| In Vitro | The barks of Eucommia ulmoides (Eucommiae Cortex, Eucommiaceae) have been used as a traditional medicine in Korea, Japan, and China to treat hypertension, reinforce the muscles and bones, and recover the damaged liver and kidney functions. Feretoside increases expression of HSF1 by a factor of 1.214, 1.144, 1.153, 1.114, 1.159, 1.041, and 1.167 at 3 mm, respectively[1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 696.3±55.0 °C at 760 mmHg |
| Flash Point | 250.9±25.0 °C |
| Exact Mass | 404.131866 |
| PSA | 175.37000 |
| LogP | -2.72 |
| Vapour Pressure | 0.0±5.0 mmHg at 25°C |