Home
Products
Tetrahydrojatrorrhizine
| Product Name | Tetrahydrojatrorrhizine |
| Price: | $94.5 / 10mg |
| Catalog No.: | CN00051 |
| CAS No.: | 27313-86-6 |
| Molecular Formula: | C20H23NO4 |
| Molecular Weight: | 341.41 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The bulbs of Corydalis yanhusuo |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)ccc2c1CN1CCc3c(C1C2)cc(c(c3)O)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Corypalmine is an alkaloid from Corydalis chaerophylla. Corypalmine is an antifungal. |
| Density | 1.29g/cm3 |
| Boiling Point | 501.2ºC at 760mmHg |
| Flash Point | 256.9ºC |
| Exact Mass | 341.16300 |
| PSA | 51.16000 |
| LogP | 3.01140 |