Home
Products
Neoandrographolide
| Product Name | Neoandrographolide |
| Price: | $62 / 20mg |
| Catalog No.: | CN08693 |
| CAS No.: | 27215-14-1 |
| Molecular Formula: | C26H40O8 |
| Molecular Weight: | 480.60 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Andrographis paniculata (Burm. f.) Nees |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC[C@]2(C)CCC[C@@]3([C@@H]2CCC(=C)[C@H]3CCC2=CCOC2=O)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Neoandrographolide is a diterpenoid from the Andrographis paniculata (Acanthaceae). |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 668.1±55.0 °C at 760 mmHg |
| Flash Point | 220.1±25.0 °C |
| Exact Mass | 480.272308 |
| PSA | 125.68000 |
| LogP | 2.11 |
| Vapour Pressure | 0.0±4.6 mmHg at 25°C |
| Storage condition | 2-8C |