Home
Products
Miltirone
| Product Name | Miltirone |
| Price: | $176 / 5mg |
| Catalog No.: | CN08835 |
| CAS No.: | 27210-57-7 |
| Molecular Formula: | C19H22O2 |
| Molecular Weight: | 282.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Red powder |
| Source: | The roots of Salvia miltiorrhiza Bge. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(C1=Cc2ccc3c(c2C(=O)C1=O)CCCC3(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Miltirone is a natural compound present in the root of Salvia miltiorrhiza. Miltirone is a central benzodiazepine receptor partial agonist, with an IC50 of 0.3 μM[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 421.6±45.0 °C at 760 mmHg |
| Flash Point | 179.4±14.4 °C |
| Exact Mass | 282.161987 |
| PSA | 34.14000 |
| LogP | 5.67 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |