Home
Products
2'-Methoxykurarinone
| Product Name | 2'-Methoxykurarinone |
| Price: | $290 / 5mg |
| Catalog No.: | CN05150 |
| CAS No.: | 270249-38-2 |
| Molecular Formula: | C27H32O6 |
| Molecular Weight: | 452.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Sophora flavescens Ait. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c(c2c1C(=O)C[C@H](O2)c1ccc(cc1OC)O)C[C@H](C(=C)C)CC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (2S)-2'-Methoxykurarinone, a compound isolated from the roots of Sophora flavescens, has anti-inflammatory, antipyretic, antidiabetic, and antineoplastic effects. (2S)-2'-Methoxykurarinone (MK) inhibits osteoclastogenesis and bone resorption through down-regulation of RANKL signaling. (2S)-2'-Methoxykurarinone (MK) displays cytotoxic activity against human myeloid leukemia HL-60 cells[1][2]. |
| Density | 1.171±0.06 g/cm3 (20 ºC 760 Torr) |
| Boiling Point | 643.6±55.0 °C at 760 mmHg |
| Flash Point | 213.2±25.0 °C |
| Exact Mass | 452.219879 |
| PSA | 85.22000 |
| LogP | 7.05 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |