Home
Products
Lariciresinol
| Product Name | Lariciresinol |
| Price: | $380 / 5mg |
| Catalog No.: | CN02954 |
| CAS No.: | 27003-73-2 |
| Molecular Formula: | C20H24O6 |
| Molecular Weight: | 360.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The herbs of Phyllanthus niruri |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@H]1[C@H](CO[C@@H]1c1ccc(c(c1)OC)O)Cc1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lariciresinol is a compound isolated from Arabidopsis thaliana[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 568.4±50.0 °C at 760 mmHg |
| Flash Point | 297.6±30.1 °C |
| Exact Mass | 360.157288 |
| PSA | 88.38000 |
| LogP | 1.64 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |