Home
Products
6-Methoxyflavone
| Product Name | 6-Methoxyflavone |
| Price: | Inquiry |
| Catalog No.: | CN04390 |
| CAS No.: | 26964-24-9 |
| Molecular Formula: | C16H12O3 |
| Molecular Weight: | 252.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Sophora flavescens |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1)c(=O)cc(o2)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.24 g/cm3 |
| Boiling Point | 421.2ºC at 760 mmHg |
| Flash Point | 200.3ºC |
| Exact Mass | 252.07900 |
| PSA | 39.44000 |
| LogP | 3.46860 |
| Vapour Pressure | 2.66E-07mmHg at 25°C |