Home
Products
Oxysophocarpine
| Product Name | Oxysophocarpine |
| Price: | $46 / 20mg |
| Catalog No.: | CN02076 |
| CAS No.: | 26904-64-3 |
| Molecular Formula: | C15H22N2O2 |
| Molecular Weight: | 262.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Styphnolobium japonicum (L.) Schott. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C1C=CC[C@H]2N1C[C@@H]1CCC[N@@+]3([C@@H]1[C@@H]2CCC3)[O-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Oxysophocarpine is an alkaloid extracted from Siphocampylus verticillatus. Oxysophocarpine has neuroprotective and anti-nociceptive effects on the central and peripheral nervous systems[1]. Oxysophocarpine inhibits the growth and metastasis of oral squamous cell carcinoma (OSCC)[2]. |
| In Vitro | Oxysophocarpine (5 μM) inhibits proliferation and reduces migration and invasion of SCC-9 and SCC-15 oral squamous cell carcinoma (OSCC) cells in vitro[1]. |
| Exact Mass | 262.168121 |
| PSA | 49.74000 |
| LogP | -0.41 |