Home
Products
Dehydrodiisoeugenol
| Product Name | Dehydrodiisoeugenol |
| Price: | $74 / 20mg |
| Catalog No.: | CN02977 |
| CAS No.: | 2680-81-1 |
| Molecular Formula: | C20H22O4 |
| Molecular Weight: | 326.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The seeds of Myristica fragrans Houtt. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC=Cc1cc2c(c(c1)OC)OC(C2C)c1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dehydrodiisoeugenol is isolated from Myristica fragrans Houtt, shows anti-inflammatory and anti-bacterial actions[1]. Dehydrodiisoeugenol inhibits LPS- stimulated NF-κB activation and cyclooxygenase (COX)-2 gene expression in murine macrophages[2]. |
| Target | NF-κB; COX-2[2] |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 452.0±45.0 °C at 760 mmHg |
| Flash Point | 227.2±28.7 °C |
| Exact Mass | 326.151794 |
| PSA | 47.92000 |
| LogP | 4.19 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |