Home
Products
2-Benzal-4-hydroxyacetophenone
| Product Name | 2-Benzal-4-hydroxyacetophenone |
| Price: | Inquiry |
| Catalog No.: | CN04391 |
| CAS No.: | 2657-25-2 |
| Molecular Formula: | C15H12O2 |
| Molecular Weight: | 224.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Oxytropis falcata Bunge |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)C(=O)C=Cc1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 4'-Hydroxychalcone, a chalcone isolated from licorice root, with hepatoprotective activity. 4'-Hydroxychalcone inhibits TNFα-induced NF-κB activation via proteasome inhibition. 4'-Hydroxychalcone induces a rapid potassium release from mitochondrial vesicles and causes deterioration of respiratory control and oxidative phosphorylation of isolated rat liver mitochondria[1][2][3]. |
| Density | 1.191 g/cm3 |
| Boiling Point | 419.6ºC at 760 mmHg |
| Flash Point | 179.1ºC |
| Exact Mass | 224.08400 |
| PSA | 37.30000 |
| LogP | 3.28830 |
| Vapour Pressure | 1.23E-07mmHg at 25°C |