Home
Products
23-epi-26-Deoxyactein
| Product Name | 23-epi-26-Deoxyactein |
| Price: | $439 / 10mg |
| Catalog No.: | CN07333 |
| CAS No.: | 264624-38-6 |
| Molecular Formula: | C37H56O10 |
| Molecular Weight: | 660.83 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Cimicifuga racemosa |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CC(=O)O[C@@H]1C[C@]23C[C@]43CC[C@@H](C([C@@H]4CC[C@H]2[C@]2([C@@]1(C)[C@H]1[C@H](C)C[C@@]3(O[C@H]1C2)OC[C@@]1([C@H]3O1)C)C)(C)C)O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 27-Deoxyactein is a constituent isolated from Cimicifuga racemosa, prevents TCDD-induced osteoblasts damage. 27-Deoxyactein inhibits increased AhR, CYP1A1 and ERK levels[1]. |
| Density | 1.32±0.1 g/cm3 |
| Exact Mass | 660.38700 |
| PSA | 136.44000 |
| LogP | 3.71020 |
| Storage condition | -20°C |