Home
Products
Oxypeucedanin hydrate
| Product Name | Oxypeucedanin hydrate |
| Price: | $77 / 10mg |
| Catalog No.: | CN06162 |
| CAS No.: | 2643-85-8 |
| Molecular Formula: | C16H16O6 |
| Molecular Weight: | 304.29 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Cryst. |
| Source: | The roots of Angelica dahurica. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1ccc2c(o1)cc1c(c2OC[C@H](C(O)(C)C)O)cco1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Oxypeucedanin hydrate ((+)-Oxypeucedanin hydrate) is a natural product isolated from D. anethifolia. Prangol exhibits mild toxicity on fibroblasts and parental lymphoma cells[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 544.3±50.0 °C at 760 mmHg |
| Flash Point | 283.0±30.1 °C |
| Exact Mass | 304.094696 |
| PSA | 93.04000 |
| LogP | 1.31 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | 2-8℃ |