Home
Products
Rhodojaponin III
| Product Name | Rhodojaponin III |
| Price: | $234 / 10mg |
| Catalog No.: | CN08512 |
| CAS No.: | 26342-66-5 |
| Molecular Formula: | C20H32O6 |
| Molecular Weight: | 368.47 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rhododendron molle G. Don |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1[C@H]2CC[C@@H]3[C@]1(C[C@@H](O)[C@]1([C@H]([C@]3(C)O)[C@H]3[C@@H](C1(C)C)O3)O)C[C@@]2(C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rhodojaponin III is a diterpenoid from the leaves of Rhododendron molle with anti-inflammatory activity[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 557.3±50.0 °C at 760 mmHg |
| Flash Point | 290.9±30.1 °C |
| Exact Mass | 368.219879 |
| PSA | 113.68000 |
| LogP | 1.09 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |