Home
Products
2,3',4,6-Tetrahydroxybenzophenone
| Product Name | 2,3',4,6-Tetrahydroxybenzophenone |
| Price: | Inquiry |
| Catalog No.: | CN05830 |
| CAS No.: | 26271-33-0 |
| Molecular Formula: | C13H10O5 |
| Molecular Weight: | 246.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Garcinia cowa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cccc(c1)C(=O)c1c(O)cc(cc1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 489.3±33.0 °C at 760 mmHg |
| Flash Point | 263.8±21.9 °C |
| Exact Mass | 246.052826 |
| PSA | 97.99000 |
| LogP | 3.06 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |