Home
Products
(1R)-(-)-Menthyl acetate
| Product Name | (1R)-(-)-Menthyl acetate |
| Price: | Inquiry |
| Catalog No.: | CN09599 |
| CAS No.: | 2623-23-6 |
| Molecular Formula: | C12H22O2 |
| Molecular Weight: | 198.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Oil |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C[C@@H]1CC[C@H]([C@@H](C1)OC(=O)C)C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Menthyl acetate (L-Menthyl acetate) is a derivative of L-menthol. Menthyl acetate is effective to enhance 5-aminolevulinic acid (ALA) skin permeation[1]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 229.1±8.0 °C at 760 mmHg |
| Flash Point | 92.2±0.0 °C |
| Exact Mass | 198.161987 |
| PSA | 26.30000 |
| LogP | 4.10 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |