Home
Products
Denudatine
| Product Name | Denudatine |
| Price: | Inquiry |
| Catalog No.: | CN02022 |
| CAS No.: | 26166-37-0 |
| Molecular Formula: | C22H33NO2 |
| Molecular Weight: | 343.51 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Aconitum chinense Paxt. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCN1C[C@]2(C)CCC[C@]34[C@H]1[C@H](C[C@H]23)[C@]12[C@H]4[C@@H](O)[C@H](CC1)C(=C)[C@H]2O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Denudatine, is primarily isolated from plants of the genera Aconitum and Delphinium[1]. Denudatine has effects on action potential of ventricular fibers and inhibits arrhythmogenic action of aconitine[2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 488.2±45.0 °C at 760 mmHg |
| Flash Point | 242.3±27.4 °C |
| Exact Mass | 343.251129 |
| PSA | 43.70000 |
| LogP | 3.07 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Storage condition | 2-8C |