Home
Products
Linderene
| Product Name | Linderene |
| Price: | $131 / 10mg |
| Catalog No.: | CN09290 |
| CAS No.: | 26146-27-0 |
| Molecular Formula: | C15H18O2 |
| Molecular Weight: | 230.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Lindera aggregata( Sims) Kosterm |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C1[C@H]2C[C@H]2[C@]2([C@H]1[C@@H](O)c1c(C2)occ1C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lindenenol is isolated from Radix linderae, with antioxidant and antibacterial activities[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 265.4±30.0 °C at 760 mmHg |
| Flash Point | 114.3±24.6 °C |
| Exact Mass | 230.130676 |
| PSA | 33.37000 |
| LogP | 3.10 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8C |