Home
Products
Rhodojaponin II
| Product Name | Rhodojaponin II |
| Price: | $234 / 10mg |
| Catalog No.: | CN08511 |
| CAS No.: | 26116-89-2 |
| Molecular Formula: | C22H34O7 |
| Molecular Weight: | 410.51 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Rhododendron molle G. Don |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@@H]1C[C@@]23C[C@@]([C@@H]([C@H]2O)CC[C@H]3[C@@]([C@H]2[C@@]1(O)C(C)(C)[C@@H]1[C@H]2O1)(C)O)(C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Rhodojaponin II is a diterpenoid from the leaves of Rhododendron molle with anti-inflammatory activity[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 569.4±50.0 °C at 760 mmHg |
| Flash Point | 194.6±23.6 °C |
| Exact Mass | 410.230438 |
| PSA | 119.75000 |
| LogP | 0.56 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |