Home
Products
Cyanidin-3,5-O-diglucoside chloride
| Product Name | Cyanidin-3,5-O-diglucoside chloride |
| Price: | Inquiry |
| Catalog No.: | CN05103 |
| CAS No.: | 2611-67-8 |
| Molecular Formula: | C27H31O16Cl |
| Molecular Weight: | 647.0 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Vaccinium myrtillus |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](Oc2cc(O)cc3c2cc(O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)c([o+]3)c2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1O)O)O.[Cl-] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cyanidin 3,5-diglucoside chloride is a type of anthocyanin. Cyanidin 3,5-diglucoside chloride inhibits hyperbaric pressure-induced GLAST decrease. Cyanidin 3,5-diglucoside chloride has the potential for the research of glaucoma[1]. |
| Exact Mass | 646.13000 |
| PSA | 272.59000 |
| Storage condition | 2-8°C |