Home
Products
Byakangelicol
| Product Name | Byakangelicol |
| Price: | $146 / 10mg |
| Catalog No.: | CN06276 |
| CAS No.: | 26091-79-2 |
| Molecular Formula: | C17H16O6 |
| Molecular Weight: | 316.31 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | White cryst. |
| Source: | The roots of Angelica dahurica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c2ccoc2c(c2c1ccc(=O)o2)OC[C@H]1OC1(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Byakangelicol, isolated from Angelica dahurica, inhibits interleukin-1beta (IL-1beta) -induced prostaglandin E2 (PGE2) release in A549 cells mediated by suppression of cyclooxygenase-2 (COX-2) expression and the activity of COX-2 enzyme. Byakangelicol has therapeutic potential as an anti-inflammatory drug on airway inflammation[1]. |
| Target | COX-2 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 503.4±50.0 °C at 760 mmHg |
| Flash Point | 258.3±30.1 °C |
| Exact Mass | 316.094696 |
| PSA | 74.34000 |
| LogP | 2.05 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | 2-8C |