Home
Products
Ligustroflavone
| Product Name | Ligustroflavone |
| Price: | $74 / 20mg |
| Catalog No.: | CN05211 |
| CAS No.: | 260413-62-5 |
| Molecular Formula: | C33H40O18 |
| Molecular Weight: | 724.67 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The leaves of Turpinia montana. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1ccc(cc1)c1oc2cc(O[C@@H]3O[C@H](CO[C@@H]4O[C@@H](C)[C@@H]([C@H]([C@H]4O)O)O)[C@H]([C@@H]([C@H]3O[C@@H]3O[C@@H](C)[C@@H]([C@H]([C@H]3O)O)O)O)O)cc(c2c(=O)c1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ligustroflavone, extracted from Ligustrum lucidum, is a potential candidate as calcium-sensing receptor (CaSR) antagonist. Ligustroflavone exhibits protective effects against diabetic osteoporosis in mice[1]. |
| Target | CaSR[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 1028.5±65.0 °C at 760 mmHg |
| Flash Point | 325.2±27.8 °C |
| Exact Mass | 724.221436 |
| PSA | 287.89000 |
| LogP | 1.56 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |