Home
Products
Calenduloside E
| Product Name | Calenduloside E |
| Price: | $190 / 10mg |
| Catalog No.: | CN07203 |
| CAS No.: | 26020-14-4 |
| Molecular Formula: | C36H56O9 |
| Molecular Weight: | 632.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Aralia elata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O[C@@H]1[C@@H](O)[C@@H](O[C@@H]([C@H]1O)C(=O)O)O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2CC(C)(C)CC1)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Calenduloside E (CE) is a natural pentacyclic triterpenoid saponin extracted from Aralia elata. Calenduloside E (CE) has anti-apoptotic potent by targeting heat shock protein 90 (Hsp90)[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 750.8±60.0 °C at 760 mmHg |
| Flash Point | 228.6±26.4 °C |
| Exact Mass | 632.392456 |
| PSA | 153.75000 |
| LogP | 7.04 |
| Vapour Pressure | 0.0±5.7 mmHg at 25°C |