Home
Products
Nimbolide
| Product Name | Nimbolide |
| Price: | Inquiry |
| Catalog No.: | CN07337 |
| CAS No.: | 25990-37-8 |
| Molecular Formula: | C27H30O7 |
| Molecular Weight: | 466.52 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The barks of Azadirachta indica |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC(=O)CC1C2(C)C(OC3C2=C(C)C(C3)c2cocc2)C2C3C1(C)C(=O)C=CC3(C)C(=O)O2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Nimbolide is a triterpene derived from the leaves and flowers of neem (Azadirachta indica L). Nimbolide induces apoptosis through inactivation of NF-κB. Nimbolide inhibits CDK4/CDK6 kinase activity. Nimbolide suppresses the NF-κB, Wnt, PI3K-Akt, MAPK and JAK-STAT signaling pathways[1]. |
| Target | NF-κB CDK4 CDK6 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 608.6±55.0 °C at 760 mmHg |
| Flash Point | 321.9±31.5 °C |
| Exact Mass | 466.199158 |
| PSA | 92.04000 |
| LogP | 2.66 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |