Home
Products
Allura Red AC
| Product Name | Allura Red AC |
| Price: | $31 / 20mg |
| Catalog No.: | CN06665 |
| CAS No.: | 25956-17-6 |
| Molecular Formula: | C18H14N2Na2O8S2 |
| Molecular Weight: | 496.42 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Red powder |
| Source: | |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1cc(c(cc1N=Nc1c(O)ccc2c1ccc(c2)S(=O)(=O)[O-])C)S(=O)(=O)O.[Na+].[Na+] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Allura Red AC, a food colourant, is dark red and water-soluble powder or granules used in various applications, such as in drinks, syrups, sweets and cereals. Allura Red AC has the ability to quench the intrinsic fluorescence of HSA through static quenching[1]. |
| Exact Mass | 495.998688 |
| PSA | 185.34000 |
| LogP | 5.24760 |