Home
Products
Liensinine
| Product Name | Liensinine |
| Price: | $114 / 20mg |
| Catalog No.: | CN02177 |
| CAS No.: | 2586-96-1 |
| Molecular Formula: | C37H42N2O6 |
| Molecular Weight: | 610.75 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | White powder |
| Source: | The plantule of Nelumbo nucifera Gaertn. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2CCN([C@@H](c2cc1Oc1cc(ccc1O)C[C@H]1N(C)CCc2c1cc(OC)c(c2)OC)Cc1ccc(cc1)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Liensinine is an autophagy/mitophagy inhibitor. Liensinine, a major isoquinoline alkaloid, extracted from the seed embryo of Nelumbo nucifera Gaertn, has a wide range of biological activities, including anti-arrhythmias, anti-hypertension, anti-pulmonary fibrosis, relaxation on vascular smooth muscle, etc[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 722.0±60.0 °C at 760 mmHg |
| Flash Point | 390.4±32.9 °C |
| Exact Mass | 610.304260 |
| PSA | 83.86000 |
| LogP | 4.84 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |