Home
Products
Velutin
| Product Name | Velutin |
| Price: | $219 / 5mg |
| Catalog No.: | CN05436 |
| CAS No.: | 25739-41-7 |
| Molecular Formula: | C17H14O6 |
| Molecular Weight: | 314.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The leaves of Vernonia flexuosa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c2c(c1)oc(cc2=O)c1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Velutin is an aglycone extracted from Korean Mistletoe, with inhibitory activity against melanin biosynthesis. Velutin reduces osteoclast differentiation and down-regulates HIF-1α through the NF-κB pathway[1][2]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 567.5±50.0 °C at 760 mmHg |
| Flash Point | 213.1±23.6 °C |
| Exact Mass | 314.079041 |
| PSA | 89.13000 |
| LogP | 2.06 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |