Home
Products
Delta-Tocotrienol
| Product Name | Delta-Tocotrienol |
| Price: | Inquiry |
| Catalog No.: | CN03685 |
| CAS No.: | 25612-59-3 |
| Molecular Formula: | C27H40O2 |
| Molecular Weight: | 396.61 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Oil |
| Source: | From palm oil. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C(=CCC[C@]1(C)CCc2c(O1)c(C)cc(c2)O)/CC/C=C(/CCC=C(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | δ-Tocotrienol is a Vitamin E in vegetables, fruits, seeds, nuts, grains and oils. Vitamin E has become well known for its role as an antioxidant, in lowering cholesterol and other lipids, as a neuroprotective and anticancer agent, and in cardiovascular disease protection. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 517.3±39.0 °C at 760 mmHg |
| Flash Point | 212.8±21.3 °C |
| Exact Mass | 396.302826 |
| PSA | 29.46000 |
| LogP | 9.84 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | −20°C |