Home
Products
3-Epioleanolic acid
| Product Name | 3-Epioleanolic acid |
| Price: | $307 / 10mg |
| Catalog No.: | CN07723 |
| CAS No.: | 25499-90-5 |
| Molecular Formula: | C30H48O3 |
| Molecular Weight: | 456.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Stauntonia hexaphylla |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2CC(C)(C)CC1)C(=O)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-Epioleanolic acid is an active component of Verbena officinalis Linn, with anti-inflammatory activity[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 553.5±50.0 °C at 760 mmHg |
| Flash Point | 302.6±26.6 °C |
| Exact Mass | 456.360352 |
| PSA | 57.53000 |
| LogP | 9.06 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Storage condition | 2-8°C |