Home
Products
Demethyleneberberine
| Product Name | Demethyleneberberine |
| Price: | $117 / 10mg |
| Catalog No.: | CN01076 |
| CAS No.: | 25459-91-0 |
| Molecular Formula: | C19H18NO4 |
| Molecular Weight: | 324.35 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Yellow powder |
| Source: | The roots of Coptis chinensis Franch. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(OC)ccc2c1c[n+]1CCc3c(c1c2)cc(c(c3)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Demethyleneberberine is a natural mitochondria-targeted antioxidant. Demethyleneberberine alleviates mice colitis and inhibits the inflammatory responses by inhibiting NF-κB pathway and regulating the balance of Th cells. Demethyleneberberine could serve as a AMPK activator for treating non-alcoholic fatty liver disease (NAFLD)[1][2][3]. |
| Exact Mass | 323.11600 |
| PSA | 59.64000 |
| LogP | 1.64990 |