Home
Products
Acevaltrate
| Product Name | Acevaltrate |
| Price: | $146 / 20mg |
| Catalog No.: | CN03059 |
| CAS No.: | 25161-41-5 |
| Molecular Formula: | C24H32O10 |
| Molecular Weight: | 480.51 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The whole plants of Valeriana jatamansi. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(CC(=O)O[C@@H]1OC=C(C2=C[C@@H]([C@@]3([C@@H]12)CO3)OC(=O)CC(OC(=O)C)(C)C)COC(=O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Acevaltrate, isolated from Valeriana glechomifolia, inhibits the Na+/K+-ATPase activity in the rat kidney and brain hemispheres with IC50s of 22.8±1.1 μM and 42.3±1.0 μM, respectively[1]. |
| Target | IC50: 22.8±1.1 μM (Na+/K+-ATPase, in rat kidney), 42.3±1.0 μM (Na+/K+-ATPase, in rat brain hemispheres)[1] |
| In Vitro | Acevaltrate differentiallys inhibit the activity of rat P-type ATPases in vitro. 60.7±7.3% inhibition of the rat H+/K+-ATPase is achieved at 100 µM[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 538.7±50.0 °C at 760 mmHg |
| Flash Point | 229.0±30.2 °C |
| Exact Mass | 480.199554 |
| PSA | 126.96000 |
| LogP | 1.91 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | 2-8C |