Home
Products
(-)-Epiafzelechin
| Product Name | (-)-Epiafzelechin |
| Price: | $321 / 5mg |
| Catalog No.: | CN05438 |
| CAS No.: | 24808-04-6 |
| Molecular Formula: | C15H14O5 |
| Molecular Weight: | 274.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Celastrus orbiculatus |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)[C@H]1Oc2cc(O)cc(c2C[C@H]1O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (-)-Epiafzelechin, isolated from the rhizomes, shows potent antioxidant activity with EC50 20.9 μM (EC50=5.7 μg/mL)[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 583.4±50.0 °C at 760 mmHg |
| Flash Point | 306.6±30.1 °C |
| Exact Mass | 274.084137 |
| PSA | 90.15000 |
| LogP | 1.09 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |