Home
Products
Isomangiferin
| Product Name | Isomangiferin |
| Price: | $146 / 10mg |
| Catalog No.: | CN05794 |
| CAS No.: | 24699-16-9 |
| Molecular Formula: | C19H18O11 |
| Molecular Weight: | 422.34 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Powder |
| Source: | The herbs of Mangifera indica L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)c1c(O)cc(c2c1oc1cc(O)c(cc1c2=O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isomangiferin, a natural product, is reported to have antiviral activity. |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 798.8±60.0 °C at 760 mmHg |
| Flash Point | 288.2±26.4 °C |
| Exact Mass | 422.084900 |
| PSA | 201.28000 |
| LogP | 0.13 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Storage condition | 2-8°C |