Home
Products
Demethylisoencecalin
| Product Name | Demethylisoencecalin |
| Price: | Inquiry |
| Catalog No.: | CN03288 |
| CAS No.: | 24672-84-2 |
| Molecular Formula: | C13H14O3 |
| Molecular Weight: | 218.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Centaurea solstitialis L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)c1ccc2c(c1O)C=CC(O2)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Exact Mass | 218.09400 |
| PSA | 46.53000 |
| LogP | 2.77900 |