Home
Products
Stellasterol
| Product Name | Stellasterol |
| Price: | Inquiry |
| Catalog No.: | CN02554 |
| CAS No.: | 2465-11-4 |
| Molecular Formula: | C28H46O |
| Molecular Weight: | 398.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@H]1CC[C@]2([C@H](C1)CC=C1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2[C@@H](/C=C/[C@@H](C(C)C)C)C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Stellasterol is a natural product. Stellasterol has high affinity towards Bcl-2 protein (Ki: 118.05 nM). Stellasterol is a weak α-glucosidase inhibitor[1][2]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 487.5±44.0 °C at 760 mmHg |
| Flash Point | 213.0±20.7 °C |
| Exact Mass | 398.354858 |
| PSA | 20.23000 |
| LogP | 9.60 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Storage condition | 2-8°C |