Home
Products
5'-S-Methyl-5'-thioadenosine
| Product Name | 5'-S-Methyl-5'-thioadenosine |
| Price: | Inquiry |
| Catalog No.: | CN02091 |
| CAS No.: | 2457-80-9 |
| Molecular Formula: | C11H15N5O3S |
| Molecular Weight: | 297.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Ephedra distachya |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CSC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1ncnc2N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5'-Methylthioadenosine is produced from S-adenosylmethionine and behaves as a powful inhibitory product. |
| Target | Human Endogenous Metabolite |
| In Vitro | 5'-Methylthioadenosine (MTA) can affect cellular processes in many ways. 5'-Methylthioadenosine has been shown to influence numerous critical responses of the cell including regulation of gene expression, proliferation, differentiation and apoptosis. Although most of these responses have been observed at the pharmacological level, their specificity makes it tempting to speculate that endogenous 5'-Methylthioadenosine could play a regulatory role in the cell. Finally, observations carried out in models of liver damage and cancer demonstrate a therapeutic potential for 5'-Methylthioadenosine that deserves further consideration[1]. |
| Density | 1.9±0.1 g/cm3 |
| Boiling Point | 642.7±65.0 °C at 760 mmHg |
| Flash Point | 342.5±34.3 °C |
| Exact Mass | 297.089569 |
| PSA | 144.61000 |
| LogP | 0.67 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Storage condition | −20°C |