Home
Products
Gardenoside
| Product Name | Gardenoside |
| Price: | $277 / 10mg |
| Catalog No.: | CN03112 |
| CAS No.: | 24512-62-7 |
| Molecular Formula: | C17H24O11 |
| Molecular Weight: | 404.37 g/mol |
| Purity: | >=98% |
| Type of Compound: | Iridoids |
| Physical Desc.: | Powder |
| Source: | The fruits of Gardenia jasminoides Ellis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2OC=C([C@@H]3[C@H]2[C@](O)(CO)C=C3)C(=O)OC)[C@@H]([C@H]([C@@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Gardenoside is a natural compound found in Gardenia fruits, with hepatoprotective properties. Gardenoside suppresses the pain of chronic constriction injury by regulating the P2X3 and P2X7 receptors. Gardenoside has an inhibitory effect on free fatty acids (FFA)-induced cellular steatosis[1][2]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 672.8±55.0 °C at 760 mmHg |
| Flash Point | 242.1±25.0 °C |
| Exact Mass | 404.131866 |
| PSA | 175.37000 |
| LogP | -4.66 |
| Vapour Pressure | 0.0±4.7 mmHg at 25°C |