Home
Products
Dimethylacrylshikonin
| Product Name | Dimethylacrylshikonin |
| Price: | Inquiry |
| Catalog No.: | CN05896 |
| CAS No.: | 24502-79-2 |
| Molecular Formula: | C21H22O6 |
| Molecular Weight: | 370.39 g/mol |
| Purity: | >=98% |
| Type of Compound: | Quinones |
| Physical Desc.: | Powder |
| Source: | The roots of Lithosperraum erythrorhizon Sieb. et Zucc. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CC[C@H](C1=CC(=O)c2c(C1=O)c(O)ccc2O)OC(=O)C=C(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | β,β-Dimethylacrylshikonin is a naphthoquinone derivative isolated from Arnebia nobilis, promotes angiogenesis by inducing eNOS, VEGF and HIF-1α expression through the PI3K-dependent pathway. Arnebin 1 has anti-tumor activity[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 653.2±55.0 °C at 760 mmHg |
| Flash Point | 362.8±28.0 °C |
| Exact Mass | 370.141632 |
| PSA | 100.90000 |
| LogP | 4.45 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |