Home
Products
Acetylshikonin
| Product Name | Acetylshikonin |
| Price: | $103 / 20mg |
| Catalog No.: | CN05889 |
| CAS No.: | 24502-78-1 |
| Molecular Formula: | C18H18O6 |
| Molecular Weight: | 330.33 g/mol |
| Purity: | >=98% |
| Type of Compound: | Quinones |
| Physical Desc.: | Powder |
| Source: | The roots of Lithosperraum erythrorhizon Sieb. et Zucc. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)O[C@@H](C1=CC(=O)c2c(C1=O)c(O)ccc2O)CC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Acetylshikonin, derived from the root of Lithospermum erythrorhizon, has anti-cancer and antiinflammation activity. Acetylshikonin is a non-selective cytochrome P450 inhibitor against all P450s (IC50 values range from 1.4-4.0 μM). Acetylshikonin is an AChE inhibitor and exhibits potent antiapoptosis activity[1][2][3]. |
| Target | IC50: 1.4-4.0 μM (all P450s)[2] AChE[3] |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 553.2±50.0 °C at 760 mmHg |
| Flash Point | 201.3±23.6 °C |
| Exact Mass | 330.110352 |
| PSA | 100.90000 |
| LogP | 4.57 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |