Home
Products
Isochlorogenic acid A
| Product Name | Isochlorogenic acid A |
| Price: | Inquiry |
| Catalog No.: | CN07039 |
| CAS No.: | 2450-53-5 |
| Molecular Formula: | C25H24O12 |
| Molecular Weight: | 516.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The flowerbuds of Lonicera japonica Thunb. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(O[C@@H]1C[C@@](O)(C[C@H]([C@H]1O)OC(=O)/C=C/c1ccc(c(c1)O)O)C(=O)O)/C=C/c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3,5-Dicaffeoylquinic acid is a natural phenolic acid with antioxidant and anti-inflammatory activities . |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 826.2±65.0 °C at 760 mmHg |
| Flash Point | 280.4±27.8 °C |
| Exact Mass | 516.126770 |
| PSA | 211.28000 |
| LogP | 1.05 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |
| Storage condition | ?20°C |