Home
Products
(+)-Epipinoresinol
| Product Name | (+)-Epipinoresinol |
| Price: | Inquiry |
| Catalog No.: | CN02872 |
| CAS No.: | 24404-50-0 |
| Molecular Formula: | C20H22O6 |
| Molecular Weight: | 358.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The heartwoods of Picea excelsa |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(ccc1O)C1OCC2C1COC2c1ccc(c(c1)OC)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (+)-Epipinoresinol is a lignan compound. CYP81Q3 specifically catalyzes methylenedioxy bridge (MDB) formation in (+)-Epipinoresinol to produce (+)-Pluviatilol[1]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 556.5±50.0 °C at 760 mmHg |
| Flash Point | 290.4±30.1 °C |
| Exact Mass | 358.141632 |
| LogP | 1.54 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |