Home
Products
Ethyl 4-methoxycinnamate
| Product Name | Ethyl 4-methoxycinnamate |
| Price: | $15 / 20mg |
| Catalog No.: | CN06983 |
| CAS No.: | 24393-56-4 |
| Molecular Formula: | C12H14O3 |
| Molecular Weight: | 206.24 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Kaempferia galangal L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCOC(=O)/C=C/c1ccc(cc1)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (E)-Ethyl p-methoxycinnamate is a natural product found in Kaempferia galangal with anti-inflammatory, anti-neoplastic and anti-microbial effects. (E)-Ethyl p-methoxycinnamate inhibits COX-1 and COX-2 in vitro with IC50s of 1.12 and 0.83 μM, respectively[1]. |
| Target | COX-1:1.12 μM (IC50) COX-2:0.83 μM (IC50) |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 325.1±17.0 °C at 760 mmHg |
| Flash Point | 133.8±15.5 °C |
| Exact Mass | 206.094299 |
| PSA | 35.53000 |
| LogP | 2.65 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |