Home
Products
Cephalotaxine
| Product Name | Cephalotaxine |
| Price: | $62 / 20mg |
| Catalog No.: | CN01025 |
| CAS No.: | 24316-19-6 |
| Molecular Formula: | C18H21NO4 |
| Molecular Weight: | 315.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The barks of Cephalotaxus fortunei Hook. f. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC1=C[C@]23[C@@H]([C@@H]1O)c1cc4OCOc4cc1CCN3CCC2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Cephalotaxine is an antiviral as well as antitumor agent. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 495.2±45.0 °C at 760 mmHg |
| Flash Point | 253.3±28.7 °C |
| Exact Mass | 315.147064 |
| PSA | 51.16000 |
| LogP | 2.13 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | 2-8°C |