Home
Products
Cannabidivarin
| Product Name | Cannabidivarin |
| Price: | $62 / 10mg |
| Catalog No.: | CN03555 |
| CAS No.: | 24274-48-4 |
| Molecular Formula: | C19H26O2 |
| Molecular Weight: | 286.41 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Oil |
| Source: | The herbs of Cannabis sativa. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCc1cc(O)c(c(c1)O)[C@@H]1C=C(C)CC[C@H]1C(=C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Boiling Point | 439.4±45.0℃ at 760 mmHg |
| Flash Point | 9℃ |
| Exact Mass | 286.19300 |
| PSA | 40.46000 |
| LogP | 5.06630 |
| Storage condition | -20℃ |