Home
Products
Febrifugine
| Product Name | Febrifugine |
| Price: | $187 / 10mg |
| Catalog No.: | CN01251 |
| CAS No.: | 24159-07-7 |
| Molecular Formula: | C16H19N3O3 |
| Molecular Weight: | 301.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Dichroa febrifuga |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(Cn1cnc2c(c1=O)cccc2)CC1NCCCC1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Febrifugine is a quinazolinone alkaloid found in the roots and leaves of Dichroa febrifuga, with antimalarial activity [1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 508.2±60.0 °C at 760 mmHg |
| Flash Point | 261.1±32.9 °C |
| Exact Mass | 301.142639 |
| PSA | 84.22000 |
| LogP | -0.04 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | 2-8℃ |